CAS 99902-88-2
:N-[3-cyano-4-(3,4-dichlorophenoxy)phenyl]acetamide
Description:
N-[3-cyano-4-(3,4-dichlorophenoxy)phenyl]acetamide, with the CAS number 99902-88-2, is a synthetic organic compound characterized by its complex structure, which includes a cyano group, an acetamide moiety, and a dichlorophenoxy group. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many organic compounds with aromatic structures. It may display biological activity, potentially serving as a pharmaceutical intermediate or a research chemical, although specific biological properties would depend on its interactions at the molecular level. The presence of the cyano and dichlorophenoxy groups suggests potential applications in agrochemicals or medicinal chemistry, where such functionalities can influence the compound's reactivity and biological interactions. Safety and handling precautions are essential, as with many synthetic chemicals, due to potential toxicity or environmental impact. Overall, this compound's unique structural features contribute to its potential utility in various chemical applications.
Formula:C15H10Cl2N2O2
InChI:InChI=1/C15H10Cl2N2O2/c1-9(20)19-11-2-5-15(10(6-11)8-18)21-12-3-4-13(16)14(17)7-12/h2-7H,1H3,(H,19,20)
Synonyms:- acetamide, N-[3-cyano-4-(3,4-dichlorophenoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-[3-CYANO-4-(3,4-DICHLOROPHENOXY)PHENYL]-ACETAMIDE
CAS:Formula:C15H10Cl2N2O2Molecular weight:321.1581
