
CAS 99902-94-0
:2-(3,4-Dichlorophenoxy)-4-pyridinecarbonitrile
Description:
2-(3,4-Dichlorophenoxy)-4-pyridinecarbonitrile, with the CAS number 99902-94-0, is a chemical compound that belongs to the class of pyridine derivatives. It features a pyridine ring substituted with a cyano group and is further substituted with a 3,4-dichlorophenoxy group. This compound is typically characterized by its moderate to high lipophilicity, which can influence its solubility in organic solvents. It may exhibit biological activity, making it of interest in agricultural or pharmaceutical applications, particularly as a potential herbicide or pesticide. The presence of chlorine atoms in the phenoxy group can enhance its stability and reactivity. Additionally, the cyano group contributes to its electronic properties, potentially affecting its interaction with biological targets. Safety and handling precautions are essential, as with many chlorinated compounds, due to potential toxicity and environmental impact. Overall, 2-(3,4-Dichlorophenoxy)-4-pyridinecarbonitrile is a compound of interest in various chemical research fields, particularly in the development of agrochemicals.
Formula:C12H6Cl2N2O
InChI:InChI=1S/C12H6Cl2N2O/c13-10-2-1-9(6-11(10)14)17-12-5-8(7-15)3-4-16-12/h1-6H
InChI key:InChIKey=IFKUMJHUUPRDGR-UHFFFAOYSA-N
SMILES:O(C1=CC(C#N)=CC=N1)C2=CC(Cl)=C(Cl)C=C2
Synonyms:- 2-(3,4-Dichlorophenoxy)-4-pyridinecarbonitrile
- 4-Pyridinecarbonitrile, 2-(3,4-dichlorophenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
