CAS 99902-96-2
:5-bromo-2-(3,4-dichlorophenoxy)pyridine
Description:
5-Bromo-2-(3,4-dichlorophenoxy)pyridine is an organic compound characterized by its pyridine ring, which is substituted at the 5-position with a bromine atom and at the 2-position with a 3,4-dichlorophenoxy group. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. Its molecular structure suggests potential applications in agrochemicals, particularly as a herbicide or pesticide, due to the presence of the chlorophenoxy moiety, which is known for its herbicidal properties. The bromine and chlorine substituents can influence the compound's reactivity and biological activity, making it of interest in medicinal chemistry and environmental science. Additionally, the presence of halogens often enhances the compound's stability and lipophilicity, which can affect its bioavailability and environmental persistence. Safety data should be consulted for handling and exposure risks, as halogenated compounds can pose health and environmental hazards.
Formula:C11H6BrCl2NO
InChI:InChI=1/C11H6BrCl2NO/c12-7-1-4-11(15-6-7)16-8-2-3-9(13)10(14)5-8/h1-6H
Synonyms:- pyridine, 5-bromo-2-(3,4-dichlorophenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
