CAS 99903-02-3

6-Chloro-3-pyridinesulfinic acid

Description:

6-Chloro-3-pyridinesulfinic acid is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 6-position and a sulfinic acid functional group (-SO2H) at the 3-position contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in water due to the sulfinic acid group, which can ionize in solution. It is often used in organic synthesis and as a reagent in various chemical reactions, particularly in the preparation of other sulfur-containing compounds. The sulfinic acid group can act as a nucleophile, making it useful in electrophilic substitution reactions. Additionally, the chlorine substituent can enhance the reactivity of the compound, allowing for further functionalization. Safety precautions should be taken when handling this compound, as with many chlorinated and sulfonated compounds, due to potential toxicity and environmental concerns.

Formula: C₅H₄ClNO₂S

InChI: InChI=1S/C5H4ClNO2S/c6-5-2-1-4(3-7-5)10(8)9/h1-3H,(H,8,9)

InChI key: InChIKey=XKLNBCWWGSOFEL-UHFFFAOYSA-N

SMILES: S(=O)(O)C=1C=CC(Cl)=NC1

Synonyms:

• 6-Chloro-3-pyridinesulfinic acid
• 3-Pyridinesulfinic acid, 6-chloro-