CymitQuimica logo

CAS 99907-80-9

:

Methyl 2-amino-5,8-dimethoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate

Description:
Methyl 2-amino-5,8-dimethoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate, with the CAS number 99907-80-9, is a chemical compound that belongs to the class of naphthalene derivatives. It features a tetrahydronaphthalene core, which is characterized by its bicyclic structure, and includes functional groups such as an amino group and methoxy groups, contributing to its potential biological activity. The presence of the carboxylate moiety suggests that it may exhibit acidic properties, while the methoxy groups can influence its solubility and reactivity. This compound may be of interest in medicinal chemistry due to its structural features, which could be associated with various pharmacological effects. Additionally, the presence of multiple substituents can lead to diverse interactions with biological targets. However, specific information regarding its toxicity, stability, and applications would require further investigation and analysis in the context of chemical safety and efficacy.
Formula:C14H19NO4
InChI:InChI=1/C14H19NO4/c1-17-11-4-5-12(18-2)10-8-14(15,13(16)19-3)7-6-9(10)11/h4-5H,6-8,15H2,1-3H3
SMILES:COc1ccc(c2CC(CCc12)(C(=O)OC)N)OC
Synonyms:
  • 2-Amino-1,2,3,4-tetrahydro-5,8-dimethoxy-2-naphthalenecarboxylic acid methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.