CAS 99907-85-4

O-(2-Chlorophenyl)hydroxylamine

Description:

O-(2-Chlorophenyl)hydroxylamine is an organic compound characterized by the presence of a hydroxylamine functional group attached to a 2-chlorophenyl moiety. It typically appears as a solid or liquid, depending on its purity and specific conditions. The compound is known for its reactivity, particularly in nucleophilic substitution reactions, due to the presence of the hydroxylamine group, which can act as a nucleophile. It is often utilized in organic synthesis, particularly in the preparation of various derivatives and in the modification of aromatic compounds. The presence of the chlorine atom on the phenyl ring can influence its reactivity and solubility properties, making it a useful intermediate in the synthesis of pharmaceuticals and agrochemicals. Safety considerations are important when handling this compound, as it may pose risks such as toxicity or environmental hazards. Proper storage and handling protocols should be followed to mitigate any potential risks associated with its use.

Formula: C₆H₆ClNO

InChI: InChI=1S/C6H6ClNO/c7-5-3-1-2-4-6(5)9-8/h1-4H,8H2

InChI key: InChIKey=XSJNLLUUAMKKOW-UHFFFAOYSA-N

SMILES: O(N)C1=C(Cl)C=CC=C1

Synonyms:

• Hydroxylamine, O-(2-chlorophenyl)-
• O-(2-Chlorophenyl)hydroxylamine

o-(2-Chlorophenyl)hydroxylamine

CAS: 99907-85-4

Versatile small molecule scaffold

Formula: C₆H₆ClNO

Purity: Min. 95%

Molecular weight: 143.57 g/mol

Ref: 3D-ZDA90785