CAS 99914-42-8
:2-(2,6-dimethylphenoxy)-N-ethyl-ethanamine
Description:
2-(2,6-Dimethylphenoxy)-N-ethyl-ethanamine, with the CAS number 99914-42-8, is an organic compound characterized by its amine functional group and ether linkage. This substance features a 2,6-dimethylphenyl group, which contributes to its hydrophobic characteristics, and an ethylamine moiety that enhances its basicity. The presence of the ether bond indicates potential for solubility in organic solvents, while the amine group may engage in hydrogen bonding, influencing its reactivity and interaction with biological systems. This compound may exhibit properties typical of amines, such as being a weak base and potentially acting as a ligand in coordination chemistry. Its structural features suggest potential applications in pharmaceuticals or as an intermediate in organic synthesis. However, specific data regarding its toxicity, stability, and environmental impact would require further investigation, as these factors are crucial for understanding its practical applications and safety considerations in various contexts.
Formula:C12H19NO
InChI:InChI=1/C12H19NO/c1-4-13-8-9-14-12-10(2)6-5-7-11(12)3/h5-7,13H,4,8-9H2,1-3H3
SMILES:CCNCCOc1c(C)cccc1C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
