CymitQuimica logo

CAS 99929-11-0

:

methyl N-[2-(formylamino)-4-(methylsulfanyl)butanethioyl]isoleucylphenylalaninate

Description:
Methyl N-[2-(formylamino)-4-(methylsulfanyl)butanethioyl]isoleucylphenylalaninate, identified by its CAS number 99929-11-0, is a synthetic compound that belongs to the class of amino acid derivatives. This substance features a complex structure that includes an isoleucine moiety, which is an essential amino acid, and a phenylalanine component, contributing to its potential biological activity. The presence of a formylamino group suggests reactivity that could be exploited in various chemical reactions, while the methylsulfanyl group indicates the presence of sulfur, which may influence the compound's properties such as solubility and stability. The thioyl group further enhances its reactivity, potentially allowing for interactions with other biomolecules. Overall, this compound may exhibit unique pharmacological properties, making it of interest in medicinal chemistry and drug development. However, detailed studies would be necessary to fully elucidate its characteristics, including its solubility, stability, and biological activity.
Formula:C22H33N3O4S2
InChI:InChI=1/C22H33N3O4S2/c1-5-15(2)19(25-21(30)17(23-14-26)11-12-31-4)20(27)24-18(22(28)29-3)13-16-9-7-6-8-10-16/h6-10,14-15,17-19H,5,11-13H2,1-4H3,(H,23,26)(H,24,27)(H,25,30)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.