CAS 99936-07-9
:Benzene, (dichlorosilyl)-, homopolymer
Description:
Benzene, (dichlorosilyl)-, homopolymer, identified by CAS number 99936-07-9, is a synthetic polymer characterized by its unique structure that incorporates dichlorosilyl groups attached to a benzene backbone. This polymer exhibits properties typical of both organic and inorganic materials, resulting in enhanced thermal stability and chemical resistance. The presence of silicon in its structure contributes to its potential applications in various fields, including coatings, adhesives, and sealants, where durability and resistance to environmental factors are crucial. The polymer's physical properties, such as flexibility, tensile strength, and thermal conductivity, can vary based on its molecular weight and the degree of cross-linking. Additionally, the dichlorosilyl groups can facilitate further chemical modifications, allowing for the incorporation of additional functionalities. Overall, this homopolymer represents a versatile material with potential uses in advanced materials science and engineering applications. However, handling and processing should be conducted with care due to the presence of chlorine, which may pose health and environmental risks.
Formula:(C6H6Cl2Si)x
InChI:InChI=1S/C6H6Cl2Si/c7-9(8)6-4-2-1-3-5-6/h1-5,9H
InChI key:InChIKey=VIRVTHOOZABTPR-UHFFFAOYSA-N
SMILES:[SiH](Cl)(Cl)C1=CC=CC=C1
Synonyms:- Phenyldichlorosilane homopolymer
- Silane, dichlorophenyl-, homopolymer
- Benzene, (dichlorosilyl)-, homopolymer
- Dichlorophenylsilane homopolymer
- Poly(dichlorophenylsilane)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
