
CAS 99936-08-0
:Silane, dichloromethyl-, homopolymer
Description:
Silane, dichloromethyl-, homopolymer, with the CAS number 99936-08-0, is a polymeric substance derived from the polymerization of dichloromethyl silane. This compound typically exhibits characteristics common to silane-based polymers, including high thermal stability, chemical resistance, and good adhesion properties. It is often used in applications requiring enhanced durability and resistance to moisture and chemicals. The polymer structure contributes to its mechanical strength and flexibility, making it suitable for various industrial applications, including coatings, sealants, and adhesives. Additionally, the presence of chlorine atoms in the structure can impart unique properties, such as increased reactivity and potential for further functionalization. Overall, silane homopolymers are valued for their versatility and performance in demanding environments, particularly in the fields of materials science and engineering.
Formula:(CH4Cl2Si)x
InChI:InChI=1S/CH4Cl2Si/c1-4(2)3/h4H,1H3
InChI key:InChIKey=NWKBSEBOBPHMKL-UHFFFAOYSA-N
SMILES:[SiH](C)(Cl)Cl
Synonyms:- Dichloromethylsilane homopolymer
- Silane, dichloromethyl-, homopolymer
- Methyldichlorosilane homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
