CAS 99943-60-9
:2-phenyl-2H-chromene-3-carboxylic acid
Description:
2-Phenyl-2H-chromene-3-carboxylic acid, identified by its CAS number 99943-60-9, is a chemical compound that belongs to the class of chromenes, which are bicyclic compounds featuring a benzene ring fused to a chromene structure. This compound typically exhibits a white to off-white crystalline appearance. It is characterized by the presence of a carboxylic acid functional group, which contributes to its acidity and potential reactivity in various chemical reactions. The phenyl group attached to the chromene structure can influence its solubility and interaction with other molecules, making it of interest in organic synthesis and medicinal chemistry. Additionally, compounds of this type may exhibit biological activities, including antioxidant and anti-inflammatory properties, which are often explored in pharmacological research. Its structural features allow for potential applications in the development of pharmaceuticals, agrochemicals, and materials science. As with many organic compounds, handling should be done with care, considering safety data and proper laboratory protocols.
Formula:C16H12O3
InChI:InChI=1/C16H12O3/c17-16(18)13-10-12-8-4-5-9-14(12)19-15(13)11-6-2-1-3-7-11/h1-10,15H,(H,17,18)
SMILES:c1ccc(cc1)C1C(=Cc2ccccc2O1)C(=O)O
Synonyms:- 2H-1-benzopyran-3-carboxylic acid, 2-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.