CymitQuimica logo

CAS 99945-31-0

:

spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-ol

Description:
Spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-ol, with the CAS number 99945-31-0, is a quaternary ammonium compound characterized by its unique bicyclic structure. This compound features a spiro arrangement, which contributes to its rigidity and potential for specific interactions in biological systems. The presence of the azonium and azolidinium moieties indicates that it possesses a positive charge, making it a cationic species. This charge can influence its solubility, reactivity, and ability to interact with anionic species or biological membranes. The hydroxyl group (-OH) at the 3-position adds to its polar character, potentially enhancing its solubility in polar solvents and affecting its biological activity. Such compounds are often studied for their applications in medicinal chemistry, particularly in drug design and delivery systems, due to their ability to interact with various biological targets. Overall, the structural features of this compound suggest it may exhibit interesting pharmacological properties, warranting further investigation.
Formula:C11H20NO
InChI:InChI=1/C11H20NO/c13-11-7-9-3-4-10(8-11)12(9)5-1-2-6-12/h9-11,13H,1-8H2/q+1
SMILES:C1CCN2(C1)C1CCC2CC(C1)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.