CymitQuimica logo

CAS 99948-85-3

:

Ethanol, 2-amino-, compd. with 2-ethylhexyl hydrogen sulfate (1:1)

Description:
The chemical substance known as "Ethanol, 2-amino-, compd. with 2-ethylhexyl hydrogen sulfate (1:1)" is a complex compound that features a combination of an amino alcohol and a sulfate ester. Ethanolamine, the amino component, is characterized by its hydroxyl (-OH) and amino (-NH2) functional groups, which contribute to its hydrophilicity and ability to form hydrogen bonds. The presence of 2-ethylhexyl hydrogen sulfate introduces a hydrophobic alkyl group, enhancing the compound's surfactant properties. This compound is likely to exhibit amphiphilic behavior, making it useful in various applications, including as a surfactant or emulsifier in formulations. Its molecular interactions can facilitate solubility in both polar and non-polar environments. Additionally, the compound may possess biological activity due to the amino group, which can participate in various biochemical processes. Safety and handling considerations are important, as with many chemical substances, and appropriate precautions should be taken to mitigate any potential hazards associated with its use.
Formula:C8H18O4S·C2H7NO
InChI:InChI=1S/C8H18O4S.C2H7NO/c1-3-5-6-8(4-2)7-12-13(9,10)11;3-1-2-4/h8H,3-7H2,1-2H3,(H,9,10,11);4H,1-3H2
InChI key:InChIKey=QOYNIGGAEJZVFK-UHFFFAOYSA-N
SMILES:C(COS(=O)(=O)O)(CCCC)CC.C(CO)N
Synonyms:
  • Sulfuric acid, mono(2-ethylhexyl) ester, compd. with 2-aminoethanol (1:1)
  • Ethanol, 2-amino-, 2-ethylhexyl sulfate (salt)
  • Ethanol, 2-amino-, compd. with 2-ethylhexyl hydrogen sulfate (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.