
CAS 99948-86-4
:2-[(Dihydroxymethylsilyl)oxy]propanoic acid
Description:
2-[(Dihydroxymethylsilyl)oxy]propanoic acid, with the CAS number 99948-86-4, is an organosilicon compound characterized by the presence of both a silanol group and a carboxylic acid functional group. This compound typically exhibits properties associated with both silanes and organic acids, including potential hydrophilicity due to the hydroxymethyl groups and reactivity due to the carboxylic acid moiety. It may serve as a versatile intermediate in organic synthesis, particularly in the development of silane-based materials or as a coupling agent in various applications. The presence of the silanol group can enhance adhesion properties and improve compatibility with different substrates, making it useful in coatings, adhesives, and sealants. Additionally, the compound may exhibit unique solubility characteristics, depending on the solvent used, and could participate in various chemical reactions, such as esterification or condensation. Overall, its dual functionality allows for a range of applications in materials science and organic chemistry.
Formula:C4H10O5Si
InChI:InChI=1S/C4H10O5Si/c1-3(4(5)6)9-10(2,7)8/h3,7-8H,1-2H3,(H,5,6)
InChI key:InChIKey=OKOJMMXFIPNSJS-UHFFFAOYSA-N
SMILES:C(O[Si](C)(O)O)(C(O)=O)C
Synonyms:- 2-[(Dihydroxymethylsilyl)oxy]propanoic acid
- Propanoic acid, 2-[(dihydroxymethylsilyl)oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
