CAS 99948-87-5
:8-(1-Ethoxyethoxy)-2,6-dimethyl-1-octene
Description:
8-(1-Ethoxyethoxy)-2,6-dimethyl-1-octene is an organic compound characterized by its long carbon chain and specific functional groups. It features an octene backbone, indicating the presence of a double bond between carbon atoms, which contributes to its reactivity and potential applications in polymer chemistry and as an intermediate in organic synthesis. The ethoxyethoxy group enhances its solubility in organic solvents and may influence its physical properties, such as boiling point and viscosity. The presence of methyl groups at the 2 and 6 positions of the octene chain can affect the compound's steric hindrance and overall stability. This compound is likely to be a colorless to pale yellow liquid at room temperature, with a characteristic odor typical of alkenes. Its applications may include use in the production of surfactants, lubricants, or as a building block in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C14H28O2
InChI:InChI=1S/C14H28O2/c1-6-15-14(5)16-11-10-13(4)9-7-8-12(2)3/h13-14H,2,6-11H2,1,3-5H3
InChI key:InChIKey=YKUFXXRBFCCEKW-UHFFFAOYSA-N
SMILES:C(CCOC(OCC)C)(CCCC(C)=C)C
Synonyms:- 1-Octene, 8-(1-ethoxyethoxy)-2,6-dimethyl-
- 8-(1-Ethoxyethoxy)-2,6-dimethyl-1-octene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
