CAS 99967-79-0

Methyl 4-amino-2-ethyl-5-thiazolecarboxylate

Description:

Methyl 4-amino-2-ethyl-5-thiazolecarboxylate is an organic compound characterized by its thiazole ring, which contributes to its biological activity and chemical properties. This compound features an amino group, an ethyl substituent, and a carboxylate ester functional group, making it a versatile intermediate in organic synthesis. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylate group. The thiazole moiety is known for its role in various pharmacological applications, including antimicrobial and anti-inflammatory activities. The compound's structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if ingested or inhaled. Overall, Methyl 4-amino-2-ethyl-5-thiazolecarboxylate is a compound of interest in both synthetic and medicinal chemistry contexts.

Formula: C₇H₁₀N₂O₂S

InChI: InChI=1S/C7H10N2O2S/c1-3-4-9-6(8)5(12-4)7(10)11-2/h3,8H2,1-2H3

InChI key: InChIKey=UZEGDNGSRZILQN-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(N)N=C(CC)S1

Synonyms:

• 5-Thiazolecarboxylic acid, 4-amino-2-ethyl-, methyl ester
• Methyl 4-amino-2-ethyl-5-thiazolecarboxylate