CymitQuimica logo

CAS 99977-37-4

:

2,5-Bis[(2-methylpropyl)thio]-1,3,4-thiadiazole

Description:
2,5-Bis[(2-methylpropyl)thio]-1,3,4-thiadiazole is a chemical compound characterized by its unique structure, which includes a thiadiazole ring substituted with two 2-methylpropylthio groups. This compound is part of the thiadiazole family, known for their diverse applications in agriculture, pharmaceuticals, and materials science due to their biological activity and ability to form coordination complexes. The presence of sulfur atoms in the thiadiazole ring and the thio groups contributes to its reactivity and potential as a ligand in coordination chemistry. Additionally, the branched alkyl groups enhance its lipophilicity, which can influence its solubility and interaction with biological systems. The compound may exhibit properties such as antimicrobial or antifungal activity, making it of interest in various research fields. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks. Overall, 2,5-Bis[(2-methylpropyl)thio]-1,3,4-thiadiazole represents a versatile compound with potential applications in multiple domains.
Formula:C10H18N2S3
InChI:InChI=1S/C10H18N2S3/c1-7(2)5-13-9-11-12-10(15-9)14-6-8(3)4/h7-8H,5-6H2,1-4H3
InChI key:InChIKey=QQYOLPCBHGLHBT-UHFFFAOYSA-N
SMILES:S(CC(C)C)C=1SC(SCC(C)C)=NN1
Synonyms:
  • 2,5-Bis(isobutylthio)-1,3,4-thiadiazole
  • 1,3,4-Thiadiazole, 2,5-bis(isobutylthio)-
  • 1,3,4-Thiadiazole, 2,5-bis[(2-methylpropyl)thio]-
  • 2,5-Bis[(2-methylpropyl)thio]-1,3,4-thiadiazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.