CAS 99979-59-6
:1-(1H-Imidazol-5-yl)-3-(phosphonooxy)-2-propanone
Description:
1-(1H-Imidazol-5-yl)-3-(phosphonooxy)-2-propanone, with the CAS number 99979-59-6, is a chemical compound that features a unique combination of an imidazole ring and a phosphonooxy group. This compound is characterized by its potential biological activity, particularly in the context of enzyme inhibition and as a biochemical tool in research. The imidazole moiety contributes to its ability to interact with biological targets, while the phosphonooxy group enhances its reactivity and solubility in aqueous environments. Typically, compounds of this nature are studied for their roles in metabolic pathways and their potential therapeutic applications. The presence of both nitrogen and phosphorus in its structure suggests that it may participate in various biochemical processes, including those related to nucleic acid metabolism. Overall, this compound exemplifies the intersection of organic chemistry and biochemistry, making it a subject of interest in medicinal chemistry and drug development.
Formula:C6H9N2O5P
InChI:InChI=1S/C6H9N2O5P/c9-6(3-13-14(10,11)12)1-5-2-7-4-8-5/h2,4H,1,3H2,(H,7,8)(H2,10,11,12)
InChI key:InChIKey=YCFFMSOLUMRAMD-UHFFFAOYSA-N
SMILES:C(C(COP(=O)(O)O)=O)C1=CN=CN1
Synonyms:- 1-(1H-Imidazol-5-yl)-3-(phosphonooxy)-2-propanone
- 3-(Imidazol-4-yl)-2-oxopropyl phosphate
- 2-Propanone, 1-(1H-imidazol-5-yl)-3-(phosphonooxy)-
- 2-Propanone, 1-hydroxy-3-(imidazol-4-yl)-, 1-phosphate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
