CAS 99993-62-1
:1-(3-methylcyclohexyl)piperazine
Description:
1-(3-Methylcyclohexyl)piperazine, with the CAS number 99993-62-1, is an organic compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a 3-methylcyclohexyl group attached to one of the nitrogen atoms of the piperazine, contributing to its unique structural and chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the cyclohexyl group imparts hydrophobic characteristics, while the piperazine moiety can engage in hydrogen bonding, influencing its solubility in various solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its potential applications could include use as a building block in drug synthesis or as a ligand in coordination chemistry. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C11H22N2
InChI:InChI=1/C11H22N2/c1-10-3-2-4-11(9-10)13-7-5-12-6-8-13/h10-12H,2-9H2,1H3
SMILES:CC1CCCC(C1)N1CCNCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.