CAS 99994-22-6
:Nitron
Description:
Nitron, with the CAS number 99994-22-6, is a chemical compound that is primarily recognized for its applications in various industrial processes. It is characterized by its unique molecular structure, which contributes to its reactivity and utility in synthesis. Typically, Nitron is associated with properties such as being a colorless to pale yellow liquid, exhibiting a distinctive odor. It is known to be soluble in organic solvents, which makes it useful in formulations and reactions involving organic compounds. The compound may also possess specific functional groups that enhance its reactivity, allowing it to participate in various chemical reactions, including nitration and oxidation processes. Safety considerations are important when handling Nitron, as it may pose health risks if inhaled or ingested, and appropriate protective measures should be taken. Overall, Nitron serves as a valuable intermediate in the production of other chemicals, highlighting its significance in the field of organic chemistry and industrial applications.
Formula:C20H16N4
InChI:InChI=1S/C20H16N4/c1-4-10-17(11-5-1)21-20-22-24(19-14-8-3-9-15-19)16-23(20)18-12-6-2-7-13-18/h1-16H
InChI key:InChIKey=CWGBFIRHYJNILV-UHFFFAOYSA-N
SMILES:[N-](C=1[N+](=CN(N1)C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4
Synonyms:- Nitron (analytical reagent)
- 1H-1,2,4-Triazolium, 1,4-diphenyl-3-(phenylamino)-, hydroxide, inner salt
- 4H-1,2,4-Triazolium, 1,4-diphenyl-3-(phenylamino)-, inner salt
- Nitron
- 1H-1,2,4-Triazolium, 1,4-diphenyl-3-(phenylamino)-, inner salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.