Product Information
Name:1,3-Dibromoadamantane
Brand:Biosynth
Description:1,3-Dibromoadamantane is an organic compound that belongs to the group of organobromides. It has a chemical structure with three bromine atoms and one carbon atom, which are bonded to each other in a triangle shape. 1,3-Dibromoadamantane is soluble in solvents such as water and methanol. The reaction yield of 1,3-dibromoadamantane is 100% when it reacts with hydrochloric acid as the catalyst under optimal conditions. The reaction also occurs at a high temperature (100 degrees Celsius) and releases energy efficiently. 1,3-Dibromoadamantane can be used as a substrate molecule for the Suzuki coupling reaction.
The coordination chemistry of 1,3-dibromoadamantane involves the formation of a square planar complex with copper ions and ammonia molecules to form copper(I) ammine complexes, which are then able to bind
The coordination chemistry of 1,3-dibromoadamantane involves the formation of a square planar complex with copper ions and ammonia molecules to form copper(I) ammine complexes, which are then able to bind
Notice:Our products are intended for lab use only. For any other use, please contact us.
Chemical properties
Molecular weight:294.03 g/mol
Formula:C10H14Br2
Purity:Min. 95%
Color/Form:Powder
InChI:InChI=1S/C10H14Br2/c11-9-2-7-1-8(4-9)5-10(12,3-7)6-9/h7-8H,1-6H2
InChI key:InChIKey=HLWZKLMEOVIWRK-UHFFFAOYSA-N
SMILES:BrC12CC3CC(C1)CC(Br)(C3)C2
Technical inquiry about: 1,3-Dibromoadamantane
Please use instead the cart to request a quotation or an order
If you want to request a quotation or place an order, please instead add the desired products to your cart and then request a quotation or order from the cart. It is faster, cheaper, and you will be able to benefit from the available discounts and other advantages.
