

Product Information
Name:3-[(2,4-Difluorophenoxy)methyl]-4-methoxybenzaldehyde
Brand:Biosynth
Description:3-[(2,4-Difluorophenoxy)methyl]-4-methoxybenzaldehyde is a compound that can be synthesized using a chemical synthesis method. It belongs to the group of thiophenes and can be dissolved in methanol. This compound is commonly used in research chemicals and has properties that make it suitable for various applications.
One of the notable characteristics of 3-[(2,4-Difluorophenoxy)methyl]-4-methoxybenzaldehyde is its neutralizing ability. It has been shown to effectively neutralize certain substances or compounds, making it useful in different scientific experiments or processes.
Additionally, this compound exhibits an interesting emission profile. When excited by external stimuli, it emits specific wavelengths of light, which can be measured and analyzed for various purposes. This emission property makes it valuable in fields such as fluorescence studies or optoelectronics.
Furthermore, 3-[(2,4-Difluorophenoxy
One of the notable characteristics of 3-[(2,4-Difluorophenoxy)methyl]-4-methoxybenzaldehyde is its neutralizing ability. It has been shown to effectively neutralize certain substances or compounds, making it useful in different scientific experiments or processes.
Additionally, this compound exhibits an interesting emission profile. When excited by external stimuli, it emits specific wavelengths of light, which can be measured and analyzed for various purposes. This emission property makes it valuable in fields such as fluorescence studies or optoelectronics.
Furthermore, 3-[(2,4-Difluorophenoxy
Notice:Our products are intended for lab use only. For any other use, please contact us.
Chemical properties
Molecular weight:278.25 g/mol
Formula:C15H12F2O3
Purity:Min. 95%
InChI:InChI=1S/C15H12F2O3/c1-19-14-4-2-10(8-18)6-11(14)9-20-15-5-3-12(16)7-13(15)17/h2-8H,9H2,1H3
InChI key:InChIKey=ARAMEYDTNQOQNB-UHFFFAOYSA-N
SMILES:COc1ccc(C=O)cc1COc1ccc(F)cc1F