

Product Information
Name:Diphenylpropylphosphine
Brand:Biosynth
Description:Diphenylpropylphosphine is a chemical compound that is used as a raw material in the synthesis of quinoline derivatives. It is also used in organic synthesis for the preparation of hydroxyl groups and trifluoroacetic acid. When mixed with sodium carbonate, this compound undergoes nucleophilic attack by the hydroxyl group to form a phosphine oxide. This reaction produces polymorphic crystals with coordination geometry around a metal atom or molecule. The metal carbonyls are then reduced and converted into palladium complexes, which are pharmaceutical preparations. Diphenylpropylphosphine can be prepared through three different mechanisms: 1) the reaction between phenyldichlorophosphine and sodium carbonate; 2) the reaction between phenyldichlorophosphine and trifluoroacetic acid; 3) the reaction between phenyldichlorophosphine and hydrogen chloride gas.
Notice:Our products are intended for lab use only. For any other use, please contact us.
Chemical properties
Molecular weight:228.27 g/mol
Formula:C15H17P
Purity:Min. 95%
InChI:InChI=1S/C15H17P/c1-2-13-16(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3
InChI key:InChIKey=AAXGWYDSLJUQLN-UHFFFAOYSA-N
SMILES:CCCP(c1ccccc1)c1ccccc1