CymitQuimica logo

CAS 1000017-93-5

:

5-Chloroimidazo[1,2-a]pyridine-2-carboxylic acid

Description:
5-Chloroimidazo[1,2-a]pyridine-2-carboxylic acid is a heterocyclic compound characterized by its imidazo and pyridine rings, which contribute to its unique chemical properties. This compound features a chlorine substituent at the 5-position of the imidazo ring and a carboxylic acid functional group at the 2-position of the pyridine ring, making it a potential candidate for various chemical reactions and applications. The presence of the carboxylic acid group suggests that it can participate in acid-base reactions, while the chlorine atom may influence its reactivity and solubility. This compound is of interest in medicinal chemistry and drug development due to its structural features, which may exhibit biological activity. Additionally, its molecular structure allows for potential interactions with biological targets, making it a subject of research in pharmacology. Overall, 5-Chloroimidazo[1,2-a]pyridine-2-carboxylic acid is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C8H5ClN2O2
InChI:InChI=1S/C8H5ClN2O2/c9-6-2-1-3-7-10-5(8(12)13)4-11(6)7/h1-4H,(H,12,13)
InChI key:InChIKey=TVUHAHMCORHJBN-UHFFFAOYSA-N
SMILES:ClC=1N2C(=NC(C(O)=O)=C2)C=CC1
Synonyms:
  • Imidazo[1,2-a]pyridine-2-carboxylic acid, 5-chloro-
  • 5-Chloroimidazo[1,2-a]pyridine-2-carboxylic acid
Found 3 products.