CAS 1000018-06-3
:5-Bromo-1-methyl-1H-indazol-3-amine
Description:
5-Bromo-1-methyl-1H-indazol-3-amine is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 5-position and a methyl group at the 1-position contributes to its unique reactivity and properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water, depending on the specific conditions. It is often used in medicinal chemistry and research due to its potential biological activity, particularly in the development of pharmaceuticals targeting various diseases. The amine functional group at the 3-position can participate in further chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, the compound's structure suggests potential interactions with biological targets, which can be explored in drug discovery and development. As with many brominated compounds, it may also exhibit specific environmental and safety considerations that should be taken into account during handling and application.
Formula:C8H8BrN3
InChI:InChI=1S/C8H8BrN3/c1-12-7-3-2-5(9)4-6(7)8(10)11-12/h2-4H,1H3,(H2,10,11)
InChI key:InChIKey=BKBSBRJIGMVBFM-UHFFFAOYSA-N
SMILES:NC=1C=2C(N(C)N1)=CC=C(Br)C2
Synonyms:- 5-Bromo-1-methylindazol-3-amine
- 5-Bromo-1-methyl-1H-indazol-3-amine
- 1H-Indazol-3-amine, 5-bromo-1-methyl-
- 5-broMo-1-Methyl-3-AMino-1H-indazole
- 3-Amino-5-bromo-1-methyl-1H-indazole,97%
- 3-FLUORO-2-(TRIMETHYLSILYL)PYRIDINE 1000018-06-3
- 3-Fluoro-2-(trimethylsilyl)pyridine 1000018-06-3
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3-Amino-5-bromo-1-methyl-1H-indazole, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H8BrN3Purity:97%Color and Shape:Pale cream, PowderMolecular weight:226.083-Amino-5-bromo-1-methyl-1H-indazole
CAS:3-Amino-5-bromo-1-methyl-1H-indazoleFormula:C8H8BrN3Purity:95%Color and Shape:Pale Cream Solid-PowderMolecular weight:226.073225-Bromo-1-methyl-1H-Indazol-3-amine
CAS:Formula:C8H8BrN3Purity:97%Color and Shape:SolidMolecular weight:226.0732Ref: IN-DA000099
50gTo inquire75gTo inquire100gTo inquire100mg25.00€250mg40.00€1g60.00€5g169.00€10g256.00€25g647.00€3-Amino-5-bromo-1-methyl-1H-indazole
CAS:5-Bromo-1-methyl-1H-indazol-3-amineFormula:C8H8BrN3Purity:98%Molecular weight:226.075-Bromo-1-methyl-1H-indazol-3-amine
CAS:Formula:C8H8BrN3Purity:98%Color and Shape:SolidMolecular weight:226.0775-Bromo-1-Methyl-1H-indazol-3-amine
CAS:Please enquire for more information about 5-Bromo-1-Methyl-1H-indazol-3-amine including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C8H8BrN3Purity:Min. 95%Molecular weight:226.07 g/mol





