CymitQuimica logo

CAS 1000018-26-7

:

Methyl N-(2,2,4-trimethyl-3-oxo-1-phenylpentyl)carbamate

Description:
Methyl N-(2,2,4-trimethyl-3-oxo-1-phenylpentyl)carbamate is a synthetic organic compound characterized by its carbamate functional group, which is known for its applications in various fields, including agriculture and pharmaceuticals. This compound features a complex structure that includes a phenyl group and a branched alkyl chain, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. The presence of the ketone group in the alkyl chain suggests potential reactivity, particularly in nucleophilic addition reactions. This compound may exhibit moderate to high lipophilicity due to its hydrophobic alkyl components, influencing its solubility in organic solvents. Additionally, it may possess biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper safety measures are taken during its use.
Formula:C16H23NO3
InChI:InChI=1S/C16H23NO3/c1-11(2)14(18)16(3,4)13(17-15(19)20-5)12-9-7-6-8-10-12/h6-11,13H,1-5H3,(H,17,19)
InChI key:InChIKey=JYMRVVBXWDNNKU-UHFFFAOYSA-N
SMILES:C(C(C(C(C)C)=O)(C)C)(NC(OC)=O)C1=CC=CC=C1
Synonyms:
  • Carbamic acid, N-(2,2,4-trimethyl-3-oxo-1-phenylpentyl)-, methyl ester
  • Methyl N-(2,2,4-trimethyl-3-oxo-1-phenylpentyl)carbamate
Found 2 products.