CymitQuimica logo

CAS 1000018-56-3

:

Imidazo[1,2-a]pyrazine-2-carboxylicacid, 6-bromo-

Description:
Imidazo[1,2-a]pyrazine-2-carboxylic acid, 6-bromo- is a heterocyclic compound characterized by its fused imidazole and pyrazine rings, which contribute to its unique chemical properties. The presence of a carboxylic acid functional group enhances its acidity and potential for hydrogen bonding, making it a versatile building block in organic synthesis. The bromine substituent at the 6-position introduces additional reactivity and can influence the compound's electronic properties, potentially enhancing its biological activity. This compound is often studied for its potential applications in pharmaceuticals, agrochemicals, and materials science due to its structural features that may interact with biological targets or serve as precursors for further chemical modifications. Its solubility and stability in various solvents can vary, depending on the specific conditions and the presence of other functional groups. Overall, imidazo[1,2-a]pyrazine-2-carboxylic acid, 6-bromo- represents a class of compounds with significant interest in medicinal chemistry and related fields.
Formula:C7H4BrN3O2
InChI:InChI=1S/C7H4BrN3O2/c8-5-3-11-2-4(7(12)13)10-6(11)1-9-5/h1-3H,(H,12,13)
InChI key:KEMAWFHELKESRS-UHFFFAOYSA-N
SMILES:C1=C(N=C2N1C=C(N=C2)Br)C(=O)O
Synonyms:
  • 6-Bromoimidazo[1,2-a]pyrazine-2-carboxylic acid
Found 4 products.