CAS 1000018-59-6: Thiophene, 2-bromo-5-(diethoxymethyl)-3-methyl-

Description:Thiophene, 2-bromo-5-(diethoxymethyl)-3-methyl- is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a bromine atom at the 2-position and a diethoxymethyl group at the 5-position, along with a methyl group at the 3-position, contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the presence of the bromine and ethoxy groups, which can influence its solubility in various solvents. The bromine substituent can also enhance reactivity, making it a potential candidate for further chemical transformations, such as nucleophilic substitutions or coupling reactions. Additionally, the diethoxymethyl group may provide steric hindrance, affecting the compound's reactivity and interaction with other molecules. Overall, this compound's structure suggests it may have applications in organic synthesis or materials science, particularly in the development of functionalized thiophene derivatives.

Formula:C₁₀H₁₅BrO₂S

InChI:InChI=1S/C10H15BrO2S/c1-4-12-10(13-5-2)8-6-7(3)9(11)14-8/h6,10H,4-5H2,1-3H3

InChI key:InChIKey=XIHFWFIXJSZBPH-UHFFFAOYSA-N

SMILES:BrC=1SC(=CC1C)C(OCC)OCC

Synonyms:
2-Bromo-5-(diethoxymethyl)-3-methylthiophene
Thiophene, 2-bromo-5-(diethoxymethyl)-3-methyl-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
2-Bromo-5-(diethoxymethyl)-3-methylthiophene REF: 10-F215037CAS: 1000018-59-6	95.0%	197.00 €	Tue 22 Jul 25
Thiophene, 2-bromo-5-(diethoxymethyl)-3-methyl- REF: IN-DA00008XCAS: 1000018-59-6	- - -	To inquire	Thu 24 Jul 25
2-Bromo-5-(diethoxymethyl)-3-methylthiophene REF: 3D-AQB01859CAS: 1000018-59-6	Min. 95%	- - -	Discontinued product