CymitQuimica logo

CAS 1000021-62-4

:

tert-butyl 4-hydroxypent-2-ynoate(WXC07449)

Description:
Tert-butyl 4-hydroxypent-2-ynoate, identified by its CAS number 1000021-62-4, is an organic compound characterized by its ester functional group and a unique alkyne structure. This compound features a tert-butyl group, which contributes to its steric bulk and influences its reactivity and solubility. The presence of a hydroxyl group (–OH) on the pent-2-ynoate backbone enhances its potential for hydrogen bonding, affecting its physical properties such as boiling point and solubility in polar solvents. The alkyne moiety introduces a degree of unsaturation, which can participate in various chemical reactions, including addition reactions. Tert-butyl 4-hydroxypent-2-ynoate is typically used in organic synthesis and may serve as an intermediate in the production of more complex molecules. Its stability and reactivity are influenced by the steric and electronic effects of the tert-butyl group and the alkyne, making it a valuable compound in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C9H14O3
InChI:InChI=1S/C9H14O3/c1-7(10)5-6-8(11)12-9(2,3)4/h7,10H,1-4H3
InChI key:RMRTUWJPAWOQDS-UHFFFAOYSA-N
SMILES:CC(C#CC(=O)OC(C)(C)C)O
Synonyms:
  • tert-butyl 4-hydroxypent-2-ynoate
  • 2-Pentynoic acid, 4-hydroxy-, 1,1-dimethylethyl ester
  • tert-butyl 4-hydroxypent-2-ynoate(WXC07449)
Found 2 products.