CymitQuimica logo

CAS 10001-54-4

:

1,2,3-Benzotriazin-4(3H)-one, 3-(1-methylethyl)-

Description:
1,2,3-Benzotriazin-4(3H)-one, 3-(1-methylethyl)-, with CAS number 10001-54-4, is an organic compound that belongs to the class of benzotriazines. This substance features a benzotriazine core, which is characterized by a fused ring system containing nitrogen atoms. The presence of the 3-(1-methylethyl) substituent indicates that it has an isopropyl group attached to the benzotriazine structure, influencing its physical and chemical properties. Typically, compounds of this nature exhibit moderate solubility in organic solvents and may have limited solubility in water. They can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the reactivity of the nitrogen atoms in the ring. Additionally, benzotriazines are often studied for their potential applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C10H11N3O
InChI:InChI=1S/C10H11N3O/c1-7(2)13-10(14)8-5-3-4-6-9(8)11-12-13/h3-7H,1-2H3
InChI key:YDSIMHXQKSAODI-UHFFFAOYSA-N
SMILES:CC(C)N1C(=O)C2=CC=CC=C2N=N1
Found 2 products.