CymitQuimica logo

CAS 10002-29-6

:

Acetic acid, (2-pyridinylthio)-

Description:
Acetic acid, (2-pyridinylthio)-, also known by its CAS number 10002-29-6, is an organic compound characterized by the presence of both acetic acid and a pyridine moiety containing a sulfur atom. This compound typically exhibits properties associated with both carboxylic acids and heterocyclic compounds. It is likely to be a colorless to pale yellow liquid with a pungent odor, characteristic of acetic acid derivatives. The presence of the pyridine ring suggests potential for basicity and coordination with metal ions, while the thioether functionality may impart unique reactivity, particularly in nucleophilic substitution reactions. This compound may also exhibit solubility in polar solvents due to the carboxylic acid group, while the aromatic nature of the pyridine ring can enhance its stability and influence its interaction with biological systems. Overall, acetic acid, (2-pyridinylthio)- is of interest in various chemical applications, including synthesis and potential biological activity, although specific applications may vary based on its reactivity and functional properties.
Formula:C7H7NO2S
InChI:InChI=1S/C7H7NO2S/c9-7(10)5-11-6-3-1-2-4-8-6/h1-4H,5H2,(H,9,10)
InChI key:IGJFLPNTKLFHMW-UHFFFAOYSA-N
SMILES:C1=CC=NC(=C1)SCC(=O)O
Found 4 products.