CAS 1000339-23-0
:2-Amino-5-bromo-4-pyridinecarboxylic acid
Description:
2-Amino-5-bromo-4-pyridinecarboxylic acid is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) attached to the pyridine ring, along with a bromine atom at the 5-position. The presence of these functional groups contributes to its acidic and basic properties, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The bromine substituent can also enhance the compound's reactivity and influence its biological activity. Typically, compounds like this are of interest in medicinal chemistry and materials science due to their potential applications in drug development and as intermediates in organic synthesis. Additionally, the compound's solubility and stability can vary depending on the pH of the solution, which is an important consideration in its practical applications.
Formula:C6H5BrN2O2
InChI:InChI=1S/C6H5BrN2O2/c7-4-2-9-5(8)1-3(4)6(10)11/h1-2H,(H2,8,9)(H,10,11)
InChI key:InChIKey=JJJKKHUIIDAXKW-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(Br)=CN=C(N)C1
Synonyms:- 2-Amino-5-bromoisonicotinic acid
- 4-Pyridinecarboxylic Acid, 2-Amino-5-Bromo-
- 2-Amino-5-bromo-4-pyridinecarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Amino-5-bromoisonicotinic acid
CAS:Formula:C6H5BrN2O2Purity:97%Color and Shape:SolidMolecular weight:217.02012-Amino-5-bromoisonicotinic acid
CAS:2-Amino-5-bromoisonicotinic acidFormula:C6H5BrN2O2Purity:98%Color and Shape:SolidMolecular weight:217.02012-Amino-5-bromoisonicotinic acid
CAS:2-Amino-5-bromoisonicotinic acidFormula:C6H5BrN2O2Purity:97%Molecular weight:217.022-Amino-5-bromoisonicotinic acid
CAS:Formula:C6H5BrN2O2Purity:98%Color and Shape:SolidMolecular weight:217.0222-Amino-5-bromopyridine-4-carboxylic acid
CAS:2-Amino-5-bromopyridine-4-carboxylic acid (2ABPC) is a molecule that inhibits DNA gyrase and topoisomerase IV, which are enzymes that maintain the integrity of bacterial DNA. It binds to bacterial 16S ribosomal RNA and inhibits protein synthesis, leading to cell death by inhibiting the production of proteins vital for cell division. 2ABPC has been shown to be effective against gram-positive pathogens such as Streptococcus pneumoniae and Staphylococcus aureus. This drug also has antibacterial activity against gram negative pathogens such as Escherichia coli, Pseudomonas aeruginosa, Klebsiella pneumoniae, Proteus vulgaris, Enterobacter cloacae, Citrobacter freundii, Salmonella typhi, and Shigella dysenteriae. The antibacterial activity of 2ABPC may be due to its inhibitionFormula:C6H5BrN2O2Purity:Min. 95%Molecular weight:217.02 g/mol




