CymitQuimica logo

CAS 1000339-24-1

:

2-Fluoro-3-hydroxybenzonitrile

Description:
2-Fluoro-3-hydroxybenzonitrile is an organic compound characterized by the presence of a fluorine atom, a hydroxyl group, and a nitrile functional group attached to a benzene ring. Its molecular structure features a fluorine substituent at the second position and a hydroxyl group at the third position relative to the nitrile group, which is located at the first position. This compound is typically a white to off-white solid and is soluble in polar organic solvents. The presence of the hydroxyl group contributes to its potential as a hydrogen bond donor, while the nitrile group can participate in various chemical reactions, including nucleophilic additions. 2-Fluoro-3-hydroxybenzonitrile may exhibit interesting biological activities, making it of interest in pharmaceutical research. Its properties, such as melting point, boiling point, and reactivity, can vary based on environmental conditions and the presence of other functional groups. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C7H4FNO
InChI:InChI=1S/C7H4FNO/c8-7-5(4-9)2-1-3-6(7)10/h1-3,10H
InChI key:CVJVSXKZGFQWJK-UHFFFAOYSA-N
SMILES:c1cc(C#N)c(c(c1)O)F
Synonyms:
  • 3-Cyano-2-fluorophenol
Found 5 products.