CymitQuimica logo

CAS 1000339-45-6

:

Butyl 2,2-difluorobutanoate

Description:
Butyl 2,2-difluorobutanoate is an organic compound characterized by its ester functional group, which is derived from butanoic acid and butanol. The presence of two fluorine atoms at the 2-position of the butanoate chain significantly influences its chemical properties, including increased lipophilicity and potential reactivity. This compound typically appears as a colorless liquid with a distinctive odor, and it is soluble in organic solvents while exhibiting limited solubility in water due to its hydrophobic nature. Its molecular structure contributes to its potential applications in various fields, including pharmaceuticals, agrochemicals, and as a solvent or intermediate in organic synthesis. The fluorine substituents can enhance the compound's stability and alter its biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and exposure risks, as fluorinated compounds can exhibit unique toxicological profiles. Overall, Butyl 2,2-difluorobutanoate represents a versatile compound with significant implications in chemical research and industrial applications.
Formula:C8H14F2O2
InChI:InChI=1S/C8H14F2O2/c1-3-5-6-12-7(11)8(9,10)4-2/h3-6H2,1-2H3
InChI key:NAFILWBUFIKBOF-UHFFFAOYSA-N
SMILES:CCCCOC(=O)C(CC)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.