CymitQuimica logo

CAS 1000339-60-5

:

2-Fluoro-4-(trifluoromethyl)benzyl chloride

Description:
2-Fluoro-4-(trifluoromethyl)benzyl chloride is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a fluorine atom and a trifluoromethyl group, along with a benzyl chloride moiety. The presence of the trifluoromethyl group significantly influences its chemical properties, enhancing its lipophilicity and potentially affecting its reactivity and biological activity. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its utility in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in nucleophilic substitution reactions. The fluorine atoms contribute to the compound's stability and can also affect its interaction with biological systems. Safety precautions are necessary when handling this compound, as it may be harmful if inhaled or ingested, and it can cause skin and eye irritation. Proper storage and disposal methods should be followed to mitigate environmental impact.
Formula:C8H5ClF4
InChI:InChI=1S/C8H5ClF4/c9-4-5-1-2-6(3-7(5)10)8(11,12)13/h1-3H,4H2
InChI key:OOGWHXAQEMXPLR-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1C(F)(F)F)F)CCl
Found 3 products.