CymitQuimica logo

CAS 1000339-75-2

:

1-[4-(Ethylsulfonyl)-2-fluorophenyl]-3-methylpiperazine

Description:
1-[4-(Ethylsulfonyl)-2-fluorophenyl]-3-methylpiperazine is a chemical compound characterized by its unique structure, which includes a piperazine ring substituted with both an ethylsulfonyl group and a fluorophenyl moiety. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the sulfonyl group, which can enhance its interaction with water. The fluorine atom in the phenyl ring can influence the compound's electronic properties, potentially affecting its reactivity and biological activity. Additionally, the piperazine ring contributes to the compound's basicity, making it capable of forming salts with acids. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity linked to the piperazine scaffold, which is commonly found in various therapeutic agents. Overall, its structural features suggest a compound with diverse applications in research and development within the field of organic and medicinal chemistry.
Formula:C13H19FN2O2S
InChI:InChI=1S/C13H19FN2O2S/c1-3-19(17,18)11-4-5-13(12(14)8-11)16-7-6-15-10(2)9-16/h4-5,8,10,15H,3,6-7,9H2,1-2H3
InChI key:InChIKey=QLOVVGFUELASSZ-UHFFFAOYSA-N
SMILES:FC1=C(N2CC(C)NCC2)C=CC(S(CC)(=O)=O)=C1
Synonyms:
  • Piperazine, 1-[4-(ethylsulfonyl)-2-fluorophenyl]-3-methyl-
  • 1-[4-(Ethylsulfonyl)-2-fluorophenyl]-3-methylpiperazine
Found 1 products.