CymitQuimica logo

CAS 1000339-92-3

:

Benzeneacetonitrile,2-fluoro-5-nitro-

Description:
Benzeneacetonitrile, 2-fluoro-5-nitro- is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both a nitrile group and a fluorine atom. The presence of the nitro group at the 5-position and the fluoro group at the 2-position on the benzene ring contributes to its chemical reactivity and polarity. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is known for its applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The nitrile functional group imparts certain properties, such as increased solubility in polar solvents and potential for nucleophilic reactions. Additionally, the presence of electronegative substituents like fluorine and nitro groups can influence the compound's electronic properties, making it a subject of interest in various chemical research fields. Safety precautions should be observed when handling this compound due to its potential toxicity and environmental impact.
Formula:C8H5FN2O2
InChI:InChI=1S/C8H5FN2O2/c9-8-2-1-7(11(12)13)5-6(8)3-4-10/h1-2,5H,3H2
InChI key:SQSDEFBOBWGPAS-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1[N+](=O)[O-])CC#N)F
Found 2 products.