CAS 1000340-36-2

4-Bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid

Description:

4-Bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyridine ring fused to a pyrrole ring. The presence of a bromine atom at the 4-position of the pyrrole ring contributes to its reactivity and potential applications in medicinal chemistry. The carboxylic acid functional group at the 3-position enhances its solubility in polar solvents and allows for potential derivatization, making it useful in various chemical reactions. This compound is of interest in the field of drug discovery due to its structural features that may interact with biological targets. Additionally, its molecular properties, such as melting point, boiling point, and spectral characteristics, can provide insights into its stability and behavior in different environments. Overall, 4-Bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is a valuable compound for research and development in organic synthesis and pharmacology.

Formula: C₈H₅BrN₂O₂

InChI: InChI=1S/C8H5BrN2O2/c9-5-1-2-10-7-6(5)4(3-11-7)8(12)13/h1-3H,(H,10,11)(H,12,13)

InChI key: InChIKey=CGEPFCDRFZLRGQ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(NC1)=NC=CC2Br

Synonyms:

• 4-Bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid
• 1H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid, 4-bromo-

1H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid, 4-bromo-

CAS: 1000340-36-2

Formula: C₈H₅BrN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 241.0415

Ref: IN-DA0000DY

4-Bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid

CAS: 1000340-36-2

4-Bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid

Purity: 97%

Ref: 54-OR1039283

4-Bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid

CAS: 1000340-36-2

4-Bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is a high quality reagent that is used as an intermediate in the synthesis of other compounds. It has a CAS No. of 1000340-36-2 and can be purchased at a very competitive price. This chemical is useful for the synthesis of complex compounds, such as fine chemicals and speciality chemicals. It can also be used as a building block for versatile chemical reactions, or as a building block for the synthesis of valuable research chemicals.

Formula: C₈H₅BrN₂O₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 241.04 g/mol

Ref: 3D-AQB34036

4-Bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid

CAS: 1000340-36-2

Formula: C₈H₅BrN₂O₂

Purity: 97%

Molecular weight: 241.044

Ref: 10-F218878