CymitQuimica logo

CAS 1000340-36-2

:

4-Bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid

Description:
4-Bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyridine ring fused to a pyrrole ring. The presence of a bromine atom at the 4-position of the pyrrole ring contributes to its reactivity and potential applications in medicinal chemistry. The carboxylic acid functional group at the 3-position enhances its solubility in polar solvents and allows for potential derivatization, making it useful in various chemical reactions. This compound is of interest in the field of drug discovery due to its structural features that may interact with biological targets. Additionally, its molecular properties, such as melting point, boiling point, and spectral characteristics, can provide insights into its stability and behavior in different environments. Overall, 4-Bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is a valuable compound for research and development in organic synthesis and pharmacology.
Formula:C8H5BrN2O2
InChI:InChI=1S/C8H5BrN2O2/c9-5-1-2-10-7-6(5)4(3-11-7)8(12)13/h1-3H,(H,10,11)(H,12,13)
InChI key:InChIKey=CGEPFCDRFZLRGQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(NC1)=NC=CC2Br
Synonyms:
  • 4-Bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid
  • 1H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid, 4-bromo-
Found 5 products.