CAS 1000340-64-6: 6-Bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine
Description:6-Bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of bromine and chlorine substituents enhances its reactivity and potential applications in various chemical reactions, particularly in medicinal chemistry and material science. This compound typically exhibits moderate solubility in organic solvents, and its structure allows for potential interactions with biological targets, making it of interest in drug discovery. The bromine and chlorine atoms can participate in electrophilic substitution reactions, while the nitrogen atoms in the rings can engage in hydrogen bonding and coordination with metal ions. Additionally, the compound's molecular framework may influence its electronic properties, making it suitable for applications in organic electronics or as a building block for more complex molecules. Overall, 6-Bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine is a versatile compound with significant implications in both synthetic and applied chemistry.
Formula:C7H4BrClN2
InChI:InChI=1S/C7H4BrClN2/c8-6-3-5(9)4-1-2-10-7(4)11-6/h1-3H,(H,10,11)
InChI key:InChIKey=OVLYMSBXUYTCSP-UHFFFAOYSA-N
SMILES:ClC1=CC(Br)=NC=2NC=CC12
- Synonyms:
- 1H-Pyrrolo[2,3-B]Pyridine,6-Bromo-4-Chloro
- 6-Bromo-4-chloro-7-azaindole
- 6-Bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1H-Pyrrolo[2,3-b]pyridine, 6-bromo-4-chloro- REF: IN-DA0000EKCAS: 1000340-64-6 | 95% | To inquire | Mon 12 May 25 |
![]() | 6-Bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine REF: 10-F450345CAS: 1000340-64-6 | 95.0% | To inquire | Tue 20 May 25 |
![]() | 6-bromo-4-chloro-1h-pyrrolo[2,3-b]pyridine REF: 3D-AQB34064CAS: 1000340-64-6 | Min. 95% | - - - | Discontinued product |

1H-Pyrrolo[2,3-b]pyridine, 6-bromo-4-chloro-
Ref: IN-DA0000EK
Undefined size | To inquire |

6-Bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine
Ref: 10-F450345
1g | To inquire | ||
100mg | To inquire | ||
250mg | To inquire |

6-bromo-4-chloro-1h-pyrrolo[2,3-b]pyridine
Ref: 3D-AQB34064
500mg | Discontinued | Request information |