
CAS 1000340-83-9
:1H-Indole, 6-fluoro-4-nitro-
Description:
1H-Indole, 6-fluoro-4-nitro- is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a fluorine atom at the 6-position and a nitro group at the 4-position introduces distinct electronic and steric properties, influencing its reactivity and potential applications. This compound is typically a yellow to orange solid and is soluble in organic solvents. It may exhibit biological activity, making it of interest in medicinal chemistry and drug development. The nitro group can serve as a site for further chemical modifications, while the fluorine atom can enhance lipophilicity and metabolic stability. As with many nitro compounds, it may pose certain safety and environmental concerns, necessitating careful handling and disposal. Overall, 1H-Indole, 6-fluoro-4-nitro- is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C8H5FN2O2
InChI:InChI=1S/C8H5FN2O2/c9-5-3-7-6(1-2-10-7)8(4-5)11(12)13/h1-4,10H
InChI key:QPJOZMDIVCTTCI-UHFFFAOYSA-N
SMILES:C1=CNC2=C1C(=CC(=C2)F)[N+](=O)[O-]
Synonyms:- 1H-Indole, 6-fluoro-4-nitro-
- 6-Fluoro-4-nitro-1H-indole
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
