CymitQuimica logo

CAS 1000341-02-5

:

6-Chloro-5-methyl-1H-indazole

Description:
6-Chloro-5-methyl-1H-indazole is a chemical compound characterized by its indazole core, which consists of a fused five-membered and six-membered ring containing nitrogen atoms. The presence of a chlorine atom at the 6-position and a methyl group at the 5-position contributes to its unique properties. This compound is typically a solid at room temperature and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. It may exhibit biological activity, making it of interest for research in areas such as cancer treatment or other therapeutic applications. The molecular structure influences its solubility, stability, and reactivity, which are critical for its use in various chemical reactions and formulations. Additionally, safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken. Overall, 6-Chloro-5-methyl-1H-indazole represents a significant compound in the field of organic chemistry and drug development.
Formula:C8H7ClN2
InChI:InChI=1S/C8H7ClN2/c1-5-2-6-4-10-11-8(6)3-7(5)9/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=GOPYPRVEHGZBJY-UHFFFAOYSA-N
SMILES:CC=1C=C2C(=CC1Cl)NN=C2
Synonyms:
  • 1H-Indazole, 6-chloro-5-methyl-
  • 6-Chloro-5-methyl-1H-indazole
Found 4 products.