CymitQuimica logo

CAS 1000341-04-7

:

4-Fluoro-1-methyl-4-piperidinemethanol

Description:
4-Fluoro-1-methyl-4-piperidinemethanol is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a fluorine atom at the 4-position and a hydroxymethyl group at the 4-piperidinemethanol position contributes to its unique properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in polar solvents due to the hydroxyl group, which enhances its ability to engage in hydrogen bonding. The fluorine substituent can influence the compound's reactivity and biological activity, making it of interest in medicinal chemistry and drug development. Additionally, the methyl group at the nitrogen atom can affect the compound's steric and electronic properties, potentially impacting its interaction with biological targets. As with many organic compounds, safety and handling precautions are essential, as it may exhibit toxicity or other hazardous characteristics.
Formula:C7H14FNO
InChI:InChI=1S/C7H14FNO/c1-9-4-2-7(8,6-10)3-5-9/h10H,2-6H2,1H3
InChI key:InChIKey=ZACQKYSISKMVCF-UHFFFAOYSA-N
SMILES:C(O)C1(F)CCN(C)CC1
Synonyms:
  • (4-Fluoro-1-methylpiperidin-4-yl)methanol
  • 4-Fluoro-1-methyl-4-piperidinemethanol
  • 4-Piperidinemethanol, 4-fluoro-1-methyl-
Found 3 products.