CymitQuimica logo

CAS 1000341-09-2

:

3-Bromo-5-methoxy-1H-pyrrolo[3,2-b]pyridine

Description:
3-Bromo-5-methoxy-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyridine and pyrrole moieties. The presence of a bromine atom at the 3-position and a methoxy group at the 5-position contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyridine and pyrrole rings, which are often associated with various biological activities. The bromine substituent can enhance the compound's reactivity, making it a useful intermediate in synthetic chemistry. Additionally, the methoxy group may influence the compound's electronic properties and steric hindrance, affecting its interactions with biological targets. Overall, 3-Bromo-5-methoxy-1H-pyrrolo[3,2-b]pyridine is of interest for further research in both synthetic and medicinal chemistry contexts.
Formula:C8H7BrN2O
InChI:InChI=1S/C8H7BrN2O/c1-12-7-3-2-6-8(11-7)5(9)4-10-6/h2-4,10H,1H3
InChI key:InChIKey=HSUOJZLKCIEBLJ-UHFFFAOYSA-N
SMILES:BrC=1C=2C(=CC=C(OC)N2)NC1
Synonyms:
  • 3-Bromo-5-methoxy-1H-pyrrolo[3,2-b]pyridine
  • 1H-Pyrrolo[3,2-b]pyridine, 3-bromo-5-methoxy-
Found 3 products.