CAS 1000341-63-8
:4-Fluoro-7-methoxy-1H-indole
Description:
4-Fluoro-7-methoxy-1H-indole is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a fluorine atom at the 4-position and a methoxy group at the 7-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in organic solvents, reflecting its non-polar characteristics due to the aromatic nature of the indole ring. The fluorine substituent can enhance the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry and drug development. The methoxy group can also participate in various chemical reactions, such as methylation or demethylation, affecting the compound's reactivity and stability. Overall, 4-Fluoro-7-methoxy-1H-indole is a versatile compound with potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. Its specific interactions and effects would depend on the context of its use and the biological systems it interacts with.
Formula:C9H8FNO
InChI:InChI=1S/C9H8FNO/c1-12-8-3-2-7(10)6-4-5-11-9(6)8/h2-5,11H,1H3
InChI key:InChIKey=MCUHJHBCMVCIMA-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=C(F)C=C1)C=CN2
Synonyms:- 4-Fluoro-7-methoxy-1H-indole
- 1H-Indole, 4-fluoro-7-methoxy-
Sort by
Found 2 products.
