CymitQuimica logo

CAS 1000342-02-8

:

4-Thiomorpholinebutanoic acid, methyl ester, 1,1-dioxide

Description:
4-Thiomorpholinebutanoic acid, methyl ester, 1,1-dioxide, identified by its CAS number 1000342-02-8, is a chemical compound characterized by the presence of a thiomorpholine ring, which contributes to its unique properties. This compound features a butanoic acid moiety, indicating it has a four-carbon chain with a carboxylic acid functional group, esterified with a methyl group. The 1,1-dioxide designation suggests the presence of two oxygen atoms double-bonded to the sulfur atom in the thiomorpholine ring, enhancing its reactivity and solubility in polar solvents. The thiomorpholine structure imparts potential biological activity, making it of interest in medicinal chemistry. Additionally, the compound may exhibit properties such as moderate polarity, which can influence its interactions in biological systems and its behavior in various chemical environments. Overall, this compound's unique structural features position it as a candidate for further research in pharmaceutical applications and synthetic chemistry.
Formula:C9H17NO4S
InChI:InChI=1S/C9H17NO4S/c1-14-9(11)3-2-4-10-5-7-15(12,13)8-6-10/h2-8H2,1H3
InChI key:InChIKey=CQICLVQXIJLFDG-UHFFFAOYSA-N
SMILES:C(CCC(OC)=O)N1CCS(=O)(=O)CC1
Synonyms:
  • 4-Thiomorpholinebutanoic acid, methyl ester, 1,1-dioxide
Found 2 products.