CymitQuimica logo

CAS 1000342-04-0

:

7-Bromo-4-chloro-1H-pyrrolo[3,2-c]pyridine

Description:
7-Bromo-4-chloro-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of bromine and chlorine substituents enhances its reactivity and potential applications in various chemical reactions, particularly in medicinal chemistry and material science. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, making it suitable for various synthetic processes. Its structure allows for potential interactions with biological targets, which may be explored for pharmaceutical development. Additionally, the halogen substituents can influence the compound's electronic properties, potentially affecting its behavior in chemical reactions and interactions with other molecules. As with many halogenated compounds, safety precautions should be taken due to the potential for toxicity and environmental impact. Overall, 7-Bromo-4-chloro-1H-pyrrolo[3,2-c]pyridine is of interest for its unique structural features and potential applications in research and industry.
Formula:C7H4BrClN2
InChI:InChI=1S/C7H4BrClN2/c8-5-3-11-7(9)4-1-2-10-6(4)5/h1-3,10H
InChI key:InChIKey=QVOWRZHOWQAPFS-UHFFFAOYSA-N
SMILES:ClC1=C2C(=C(Br)C=N1)NC=C2
Synonyms:
  • 1H-Pyrrolo[3,2-c]pyridine, 7-bromo-4-chloro-
  • 7-Bromo-4-chloro-1H-pyrrolo[3,2-c]pyridine
Found 4 products.