CymitQuimica logo

CAS 1000342-73-3

:

6-Bromo-2,3-dihydro-1H-indol-4-ol

Description:
6-Bromo-2,3-dihydro-1H-indol-4-ol is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 6-position and a hydroxyl group at the 4-position contributes to its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit solubility in polar solvents due to the hydroxyl group. Its molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the presence of the bromine atom may enhance its reactivity in certain contexts, making it a candidate for further chemical modifications. The compound's potential applications could span medicinal chemistry, where it may serve as a scaffold for drug development, particularly in the search for new therapeutic agents. However, specific properties such as melting point, boiling point, and spectral data would require experimental determination or literature reference for precise characterization.
Formula:C8H8BrNO
InChI:InChI=1S/C8H8BrNO/c9-5-3-7-6(1-2-10-7)8(11)4-5/h3-4,10-11H,1-2H2
InChI key:InChIKey=ZHDPRPOEJUUMDH-UHFFFAOYSA-N
SMILES:OC1=C2C(=CC(Br)=C1)NCC2
Synonyms:
  • 1H-Indol-4-ol, 6-bromo-2,3-dihydro-
  • 6-Bromo-2,3-dihydro-1H-indol-4-ol
Found 3 products.