CymitQuimica logo

CAS 1000342-81-3

:

6-Bromo-4-methoxy-1H-pyrrolo[3,2-c]pyridine

Description:
6-Bromo-4-methoxy-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyridine and a pyrrole moiety. The presence of a bromine atom at the 6-position and a methoxy group at the 4-position contributes to its chemical reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential interactions with biological targets, making it of interest in drug discovery and development. The bromine substituent can enhance electrophilic reactivity, while the methoxy group may influence the compound's lipophilicity and overall pharmacokinetic properties. Additionally, the compound's unique structural features may impart specific biological activities, which can be explored in various research contexts, including anti-cancer and anti-inflammatory studies. As with many heterocycles, its synthesis and characterization are crucial for understanding its properties and potential applications in various fields of chemistry and pharmacology.
Formula:C8H7BrN2O
InChI:InChI=1S/C8H7BrN2O/c1-12-8-5-2-3-10-6(5)4-7(9)11-8/h2-4,10H,1H3
InChI key:InChIKey=YEXAAABKHINEAN-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=CC(Br)=N1)NC=C2
Synonyms:
  • 1H-Pyrrolo[3,2-c]pyridine, 6-bromo-4-methoxy-
  • 6-Bromo-4-methoxy-1H-pyrrolo[3,2-c]pyridine
Found 2 products.