CymitQuimica logo

CAS 1000342-88-0

:

2-AMINO-3,5-DIIODO-6-METHYLPYRIDINE

Description:
2-Amino-3,5-diiodo-6-methylpyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with amino and iodine groups, as well as a methyl group. The molecular structure features a six-membered aromatic ring containing one nitrogen atom, which contributes to its basicity and potential reactivity. The presence of two iodine atoms at the 3 and 5 positions enhances its electrophilic properties, making it useful in various chemical reactions, including halogenation and nucleophilic substitutions. The amino group at the 2 position can participate in hydrogen bonding and may influence the compound's solubility and reactivity. This compound is of interest in medicinal chemistry and materials science due to its potential applications in drug development and as a building block for more complex molecules. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and the presence of solvents or other reagents. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.
Formula:C6H6I2N2
InChI:InChI=1S/C6H6I2N2/c1-3-4(7)2-5(8)6(9)10-3/h2H,1H3,(H2,9,10)
InChI key:BSXUGYBTSPNQDE-UHFFFAOYSA-N
SMILES:CC1=NC(=C(C=C1I)I)N
Found 3 products.